C22H32BFN2O6 — CID 151571863
tert-butyl N-[(4S)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-4-yl]-N-methylcarbamate (PubChem CID 151571863) has the molecular formula C22H32BFN2O6 and a molecular weight of 450.32 g/mol. Its IUPAC name is tert-butyl N-[(4S)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(4S)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 151571863 |
| Molecular Formula | C22H32BFN2O6 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | tert-butyl N-[(4S)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@]1(C)COC(=O)N1c1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| InChI | InChI=1S/C22H32BFN2O6/c1-19(2,3)30-17(27)25(9)22(8)13-29-18(28)26(22)14-10-11-15(16(24)12-14)23-31-20(4,5)21(6,7)32-23/h10-12H,13H2,1-9H3/t22-/m0/s1 |
| InChIKey | QEPRPHJGAWJHIX-QFIPXVFZSA-N |
| XLogP | 3.66 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|