C21H31BClNO4 — CID 175159623
tert-butyl N-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-2-yl]-N-methylcarbamate (PubChem CID 175159623) has the molecular formula C21H31BClNO4 and a molecular weight of 407.75 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 175159623 |
| Molecular Formula | C21H31BClNO4 |
| Molecular Weight | 407.75 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl N-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1Cc2ccc(B3OC(C)(C)C(C)(C)O3)c(Cl)c2C1 |
| InChI | InChI=1S/C21H31BClNO4/c1-19(2,3)26-18(25)24(8)14-11-13-9-10-16(17(23)15(13)12-14)22-27-20(4,5)21(6,7)28-22/h9-10,14H,11-12H2,1-8H3 |
| InChIKey | BCADOMDFODZJCG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|