C26H32BFN2O4 — CID 142410855
methyl 2-[3-[[7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]amino]-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl]acetate (PubChem CID 142410855) has the molecular formula C26H32BFN2O4 and a molecular weight of 466.36 g/mol. Its IUPAC name is methyl 2-[3-[[7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]amino]-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl]acetate.
| Compound Name | methyl 2-[3-[[7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]amino]-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl]acetate |
|---|---|
| PubChem CID | 142410855 |
| Molecular Formula | C26H32BFN2O4 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | methyl 2-[3-[[7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]amino]-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl]acetate |
| SMILES | COC(=O)CC1CCc2cc(NC3CCc4c(B5OC(C)(C)C(C)(C)O5)ccc(F)c43)ncc21 |
| InChI | InChI=1S/C26H32BFN2O4/c1-25(2)26(3,4)34-27(33-25)19-9-10-20(28)24-17(19)8-11-21(24)30-22-12-15-6-7-16(13-23(31)32-5)18(15)14-29-22/h9-10,12,14,16,21H,6-8,11,13H2,1-5H3,(H,29,30) |
| InChIKey | YZMKOQRIEBLHHF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|