C20H22BF2NO3 — CID 143518191
2,6-difluoro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohepta-1,3,6-trien-1-yl]benzamide (PubChem CID 143518191) has the molecular formula C20H22BF2NO3 and a molecular weight of 373.21 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohepta-1,3,6-trien-1-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohepta-1,3,6-trien-1-yl]benzamide |
|---|---|
| PubChem CID | 143518191 |
| Molecular Formula | C20H22BF2NO3 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2,6-difluoro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohepta-1,3,6-trien-1-yl]benzamide |
| SMILES | CC1(C)OB(C2=CC=C(NC(=O)c3c(F)cccc3F)C=CC2)OC1(C)C |
| InChI | InChI=1S/C20H22BF2NO3/c1-19(2)20(3,4)27-21(26-19)13-7-5-8-14(12-11-13)24-18(25)17-15(22)9-6-10-16(17)23/h5-6,8-12H,7H2,1-4H3,(H,24,25) |
| InChIKey | DWUFCLCFNJZFCC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|