C35H27N3 — CID 169290945
2,4-diphenyl-6-(5,7,7-trimethylbenzo[g]fluoren-9-yl)-1,3,5-triazine (PubChem CID 169290945) has the molecular formula C35H27N3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2,4-diphenyl-6-(5,7,7-trimethylbenzo[g]fluoren-9-yl)-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-(5,7,7-trimethylbenzo[g]fluoren-9-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 169290945 |
| Molecular Formula | C35H27N3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2,4-diphenyl-6-(5,7,7-trimethylbenzo[g]fluoren-9-yl)-1,3,5-triazine |
| SMILES | Cc1cc2c(c3ccccc13)-c1ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc1C2(C)C |
| InChI | InChI=1S/C35H27N3/c1-22-20-30-31(27-17-11-10-16-26(22)27)28-19-18-25(21-29(28)35(30,2)3)34-37-32(23-12-6-4-7-13-23)36-33(38-34)24-14-8-5-9-15-24/h4-21H,1-3H3 |
| InChIKey | NXMAONFTTXUDLV-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |