C10H5N3O6 — CID 155271491
3-(2,3-dinitrophenyl)pyrrole-2,5-dione (PubChem CID 155271491) has the molecular formula C10H5N3O6 and a molecular weight of 263.17 g/mol. Its IUPAC name is 3-(2,3-dinitrophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,3-dinitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 155271491 |
| Molecular Formula | C10H5N3O6 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 3-(2,3-dinitrophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(c2cccc([N+](=O)[O-])c2[N+](=O)[O-])C(=O)N1 |
| InChI | InChI=1S/C10H5N3O6/c14-8-4-6(10(15)11-8)5-2-1-3-7(12(16)17)9(5)13(18)19/h1-4H,(H,11,14,15) |
| InChIKey | WHSRYCSCKRNAGU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|