C13H8N2O2 — CID 106694986
3-quinolin-8-ylpyrrole-2,5-dione (PubChem CID 106694986) has the molecular formula C13H8N2O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is 3-quinolin-8-ylpyrrole-2,5-dione.
| Compound Name | 3-quinolin-8-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 106694986 |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-quinolin-8-ylpyrrole-2,5-dione |
| SMILES | O=C1C=C(c2cccc3cccnc23)C(=O)N1 |
| InChI | InChI=1S/C13H8N2O2/c16-11-7-10(13(17)15-11)9-5-1-3-8-4-2-6-14-12(8)9/h1-7H,(H,15,16,17) |
| InChIKey | UMBKVCNSBJEUQK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|