C10H4F2N2O4 — CID 106695119
3-(2,4-difluoro-6-nitrophenyl)pyrrole-2,5-dione (PubChem CID 106695119) has the molecular formula C10H4F2N2O4 and a molecular weight of 254.15 g/mol. Its IUPAC name is 3-(2,4-difluoro-6-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-difluoro-6-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 106695119 |
| Molecular Formula | C10H4F2N2O4 |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 3-(2,4-difluoro-6-nitrophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(c2c(F)cc(F)cc2[N+](=O)[O-])C(=O)N1 |
| InChI | InChI=1S/C10H4F2N2O4/c11-4-1-6(12)9(7(2-4)14(17)18)5-3-8(15)13-10(5)16/h1-3H,(H,13,15,16) |
| InChIKey | QAJJPSCJJIQFES-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|