C10H4Br3NO2 — CID 22392309
3-(2,4,6-tribromophenyl)pyrrole-2,5-dione (PubChem CID 22392309) has the molecular formula C10H4Br3NO2 and a molecular weight of 409.86 g/mol. Its IUPAC name is 3-(2,4,6-tribromophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4,6-tribromophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22392309 |
| Molecular Formula | C10H4Br3NO2 |
| Molecular Weight | 409.86 g/mol |
| Exact Mass | 406.78 |
| IUPAC Name | 3-(2,4,6-tribromophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(c2c(Br)cc(Br)cc2Br)C(=O)N1 |
| InChI | InChI=1S/C10H4Br3NO2/c11-4-1-6(12)9(7(13)2-4)5-3-8(15)14-10(5)16/h1-3H,(H,14,15,16) |
| InChIKey | JBMFDCVHPFKUIX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.86 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|