C23H12N2O8 — CID 91091643
4-nitro-2-[5-(4-nitro-1,3-dioxoinden-2-ylidene)pent-3-enylidene]indene-1,3-dione (PubChem CID 91091643) has the molecular formula C23H12N2O8 and a molecular weight of 444.36 g/mol. Its IUPAC name is 4-nitro-2-[5-(4-nitro-1,3-dioxoinden-2-ylidene)pent-3-enylidene]indene-1,3-dione.
| Compound Name | 4-nitro-2-[5-(4-nitro-1,3-dioxoinden-2-ylidene)pent-3-enylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 91091643 |
| Molecular Formula | C23H12N2O8 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 4-nitro-2-[5-(4-nitro-1,3-dioxoinden-2-ylidene)pent-3-enylidene]indene-1,3-dione |
| SMILES | O=C1C(=CC=CCC=C2C(=O)c3cccc([N+](=O)[O-])c3C2=O)C(=O)c2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C23H12N2O8/c26-20-12-8-4-10-16(24(30)31)18(12)22(28)14(20)6-2-1-3-7-15-21(27)13-9-5-11-17(25(32)33)19(13)23(15)29/h1-2,4-11H,3H2 |
| InChIKey | NIINBJDYJVDHCY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 154.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|