C19H23N5O6 — CID 25020451
1-[[9-[[dimethyl(oxido)azaniumyl]methylamino]-4-hydroxy-1,5,10-trioxo-2H-benzo[g]isoquinolin-6-yl]amino]-N,N-dimethylmethanamine oxide (PubChem CID 25020451) has the molecular formula C19H23N5O6 and a molecular weight of 417.42 g/mol. Its IUPAC name is 1-[[9-[[dimethyl(oxido)azaniumyl]methylamino]-4-hydroxy-1,5,10-trioxo-2H-benzo[g]isoquinolin-6-yl]amino]-N,N-dimethylmethanamine oxide.
| Compound Name | 1-[[9-[[dimethyl(oxido)azaniumyl]methylamino]-4-hydroxy-1,5,10-trioxo-2H-benzo[g]isoquinolin-6-yl]amino]-N,N-dimethylmethanamine oxide |
|---|---|
| PubChem CID | 25020451 |
| Molecular Formula | C19H23N5O6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-[[9-[[dimethyl(oxido)azaniumyl]methylamino]-4-hydroxy-1,5,10-trioxo-2H-benzo[g]isoquinolin-6-yl]amino]-N,N-dimethylmethanamine oxide |
| SMILES | C[N+](C)([O-])CNc1ccc(NC[N+](C)(C)[O-])c2c1C(=O)c1c(O)c[nH]c(=O)c1C2=O |
| InChI | InChI=1S/C19H23N5O6/c1-23(2,29)8-21-10-5-6-11(22-9-24(3,4)30)14-13(10)17(26)15-12(25)7-20-19(28)16(15)18(14)27/h5-7,21-22,25H,8-9H2,1-4H3,(H,20,28) |
| InChIKey | ZPPXYOKVSIQUSH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|