C14H23N3O2 — CID 114126621
2-amino-3-[(4-methoxy-2,2-dimethylbutyl)amino]benzamide (PubChem CID 114126621) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-amino-3-[(4-methoxy-2,2-dimethylbutyl)amino]benzamide.
| Compound Name | 2-amino-3-[(4-methoxy-2,2-dimethylbutyl)amino]benzamide |
|---|---|
| PubChem CID | 114126621 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-amino-3-[(4-methoxy-2,2-dimethylbutyl)amino]benzamide |
| SMILES | COCCC(C)(C)CNc1cccc(C(N)=O)c1N |
| InChI | InChI=1S/C14H23N3O2/c1-14(2,7-8-19-3)9-17-11-6-4-5-10(12(11)15)13(16)18/h4-6,17H,7-9,15H2,1-3H3,(H2,16,18) |
| InChIKey | PHLJWXJDRZBKPZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|