C15H20ClN3O — CID 107196159
5-amino-3-chloro-2-(2,2-dicyclopropylethylamino)benzamide (PubChem CID 107196159) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,2-dicyclopropylethylamino)benzamide.
| Compound Name | 5-amino-3-chloro-2-(2,2-dicyclopropylethylamino)benzamide |
|---|---|
| PubChem CID | 107196159 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 5-amino-3-chloro-2-(2,2-dicyclopropylethylamino)benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1NCC(C1CC1)C1CC1 |
| InChI | InChI=1S/C15H20ClN3O/c16-13-6-10(17)5-11(15(18)20)14(13)19-7-12(8-1-2-8)9-3-4-9/h5-6,8-9,12,19H,1-4,7,17H2,(H2,18,20) |
| InChIKey | HZFCAJUCLVAACS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|