C14H18Cl2N2 — CID 106890529
2,6-dichloro-1-N-(2,2-dicyclopropylethyl)benzene-1,4-diamine (PubChem CID 106890529) has the molecular formula C14H18Cl2N2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 2,6-dichloro-1-N-(2,2-dicyclopropylethyl)benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-(2,2-dicyclopropylethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106890529 |
| Molecular Formula | C14H18Cl2N2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2,6-dichloro-1-N-(2,2-dicyclopropylethyl)benzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(NCC(C2CC2)C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2/c15-12-5-10(17)6-13(16)14(12)18-7-11(8-1-2-8)9-3-4-9/h5-6,8-9,11,18H,1-4,7,17H2 |
| InChIKey | NGXXMLQKNNESNP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|