C14H20Cl2N2O — CID 106890503
1-[(4-amino-2,6-dichloroanilino)methyl]-4-methylcyclohexan-1-ol (PubChem CID 106890503) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 1-[(4-amino-2,6-dichloroanilino)methyl]-4-methylcyclohexan-1-ol.
| Compound Name | 1-[(4-amino-2,6-dichloroanilino)methyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 106890503 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-[(4-amino-2,6-dichloroanilino)methyl]-4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)(CNc2c(Cl)cc(N)cc2Cl)CC1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-9-2-4-14(19,5-3-9)8-18-13-11(15)6-10(17)7-12(13)16/h6-7,9,18-19H,2-5,8,17H2,1H3 |
| InChIKey | RAUXMSAISCEFGQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|