C13H16Cl2N2 — CID 114095331
2,6-dichloro-1-N-[(1-cyclopropylcyclopropyl)methyl]benzene-1,4-diamine (PubChem CID 114095331) has the molecular formula C13H16Cl2N2 and a molecular weight of 271.19 g/mol. Its IUPAC name is 2,6-dichloro-1-N-[(1-cyclopropylcyclopropyl)methyl]benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-[(1-cyclopropylcyclopropyl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 114095331 |
| Molecular Formula | C13H16Cl2N2 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2,6-dichloro-1-N-[(1-cyclopropylcyclopropyl)methyl]benzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(NCC2(C3CC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2/c14-10-5-9(16)6-11(15)12(10)17-7-13(3-4-13)8-1-2-8/h5-6,8,17H,1-4,7,16H2 |
| InChIKey | QYWJDBKAVZLVHG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|