C12H17ClN2O2S — CID 107196717
5-amino-3-chloro-2-(4-methylsulfanylbutan-2-ylamino)benzoic acid (PubChem CID 107196717) has the molecular formula C12H17ClN2O2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(4-methylsulfanylbutan-2-ylamino)benzoic acid.
| Compound Name | 5-amino-3-chloro-2-(4-methylsulfanylbutan-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 107196717 |
| Molecular Formula | C12H17ClN2O2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-amino-3-chloro-2-(4-methylsulfanylbutan-2-ylamino)benzoic acid |
| SMILES | CSCCC(C)Nc1c(Cl)cc(N)cc1C(=O)O |
| InChI | InChI=1S/C12H17ClN2O2S/c1-7(3-4-18-2)15-11-9(12(16)17)5-8(14)6-10(11)13/h5-7,15H,3-4,14H2,1-2H3,(H,16,17) |
| InChIKey | NWSSYEYVSVHPEC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|