C13H19Cl2NOS — CID 103785111
3-[1-(3,4-dichlorophenyl)ethylamino]-2-methylsulfanylbutan-1-ol (PubChem CID 103785111) has the molecular formula C13H19Cl2NOS and a molecular weight of 308.27 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)ethylamino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[1-(3,4-dichlorophenyl)ethylamino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 103785111 |
| Molecular Formula | C13H19Cl2NOS |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)ethylamino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)NC(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2NOS/c1-8(16-9(2)13(7-17)18-3)10-4-5-11(14)12(15)6-10/h4-6,8-9,13,16-17H,7H2,1-3H3 |
| InChIKey | FUJKANORJYZIQH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |