C14H22FNO2S — CID 103785121
3-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-methylsulfanylbutan-1-ol (PubChem CID 103785121) has the molecular formula C14H22FNO2S and a molecular weight of 287.40 g/mol. Its IUPAC name is 3-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 103785121 |
| Molecular Formula | C14H22FNO2S |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 3-[1-(3-fluoro-4-methoxyphenyl)ethylamino]-2-methylsulfanylbutan-1-ol |
| SMILES | COc1ccc(C(C)NC(C)C(CO)SC)cc1F |
| InChI | InChI=1S/C14H22FNO2S/c1-9(16-10(2)14(8-17)19-4)11-5-6-13(18-3)12(15)7-11/h5-7,9-10,14,16-17H,8H2,1-4H3 |
| InChIKey | WCFGFHFHAXJYGO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |