About 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol
3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol (PubChem CID 106162577) has the molecular formula C11H18ClN3OS
and a molecular weight of 275.81 g/mol. Its IUPAC name is 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol.
Molecular Properties
| Compound Name | 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol |
| PubChem CID | 106162577 |
| Molecular Formula | C11H18ClN3OS |
| Molecular Weight | 275.81 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)Nc1nc(C)nc(Cl)c1C |
| InChI | InChI=1S/C11H18ClN3OS/c1-6-10(12)14-8(3)15-11(6)13-7(2)9(5-16)17-4/h7,9,16H,5H2,1-4H3,(H,13,14,15) |
| InChIKey | MNBUBRZQGXAYRY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol?
The IUPAC name of 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol (CID 106162577) is 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol.
What is the SMILES notation for 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol?
The canonical SMILES for 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol is CSC(CO)C(C)Nc1nc(C)nc(Cl)c1C.
What is the InChIKey of 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol?
The InChIKey is MNBUBRZQGXAYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClN3OS/c1-6-10(12)14-8(3)15-11(6)13-7(2)9(5-16)17-4/h7,9,16H,5H2,1-4H3,(H,13,14,15).
What are the key properties of 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol?
3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol has a molecular weight of 275.81 g/mol, XLogP of 2.27, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol is sourced from PubChem (CID 106162577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).