C12H22N4OS — CID 106163431
3-[(6-amino-2-ethyl-5-methylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol (PubChem CID 106163431) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 3-[(6-amino-2-ethyl-5-methylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[(6-amino-2-ethyl-5-methylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106163431 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-[(6-amino-2-ethyl-5-methylpyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol |
| SMILES | CCc1nc(N)c(C)c(NC(C)C(CO)SC)n1 |
| InChI | InChI=1S/C12H22N4OS/c1-5-10-15-11(13)7(2)12(16-10)14-8(3)9(6-17)18-4/h8-9,17H,5-6H2,1-4H3,(H3,13,14,15,16) |
| InChIKey | PIDZKAWNVNJTOI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |