C13H22ClN3O2 — CID 106257270
1-[(6-chloro-5-propan-2-ylpyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 106257270) has the molecular formula C13H22ClN3O2 and a molecular weight of 287.79 g/mol. Its IUPAC name is 1-[(6-chloro-5-propan-2-ylpyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[(6-chloro-5-propan-2-ylpyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 106257270 |
| Molecular Formula | C13H22ClN3O2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-[(6-chloro-5-propan-2-ylpyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNc1ncnc(Cl)c1C(C)C |
| InChI | InChI=1S/C13H22ClN3O2/c1-9(2)10-11(14)16-8-17-12(10)15-7-13(3,18)5-6-19-4/h8-9,18H,5-7H2,1-4H3,(H,15,16,17) |
| InChIKey | JDEHNYRIITYPMW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |