C11H18ClN3O2 — CID 106293481
1-[(6-chloro-5-methoxypyrimidin-4-yl)amino]-2-methylpentan-2-ol (PubChem CID 106293481) has the molecular formula C11H18ClN3O2 and a molecular weight of 259.74 g/mol. Its IUPAC name is 1-[(6-chloro-5-methoxypyrimidin-4-yl)amino]-2-methylpentan-2-ol.
| Compound Name | 1-[(6-chloro-5-methoxypyrimidin-4-yl)amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 106293481 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-[(6-chloro-5-methoxypyrimidin-4-yl)amino]-2-methylpentan-2-ol |
| SMILES | CCCC(C)(O)CNc1ncnc(Cl)c1OC |
| InChI | InChI=1S/C11H18ClN3O2/c1-4-5-11(2,16)6-13-10-8(17-3)9(12)14-7-15-10/h7,16H,4-6H2,1-3H3,(H,13,14,15) |
| InChIKey | WZPQNYBOKKDZEX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |