C10H14ClN3O2 — CID 115455244
[1-[[(6-chloro-5-methoxypyrimidin-4-yl)amino]methyl]cyclopropyl]methanol (PubChem CID 115455244) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is [1-[[(6-chloro-5-methoxypyrimidin-4-yl)amino]methyl]cyclopropyl]methanol.
| Compound Name | [1-[[(6-chloro-5-methoxypyrimidin-4-yl)amino]methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 115455244 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | [1-[[(6-chloro-5-methoxypyrimidin-4-yl)amino]methyl]cyclopropyl]methanol |
| SMILES | COc1c(Cl)ncnc1NCC1(CO)CC1 |
| InChI | InChI=1S/C10H14ClN3O2/c1-16-7-8(11)13-6-14-9(7)12-4-10(5-15)2-3-10/h6,15H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | IDVANIXMVQTECH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |