C9H10N2O3 — CID 90127167
N-[(E)-ethylideneamino]-3,4-dihydroxybenzamide (PubChem CID 90127167) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is N-[(E)-ethylideneamino]-3,4-dihydroxybenzamide.
| Compound Name | N-[(E)-ethylideneamino]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 90127167 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | N-[(E)-ethylideneamino]-3,4-dihydroxybenzamide |
| SMILES | C/C=N/NC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H10N2O3/c1-2-10-11-9(14)6-3-4-7(12)8(13)5-6/h2-5,12-13H,1H3,(H,11,14)/b10-2+ |
| InChIKey | DDFHITZEDYKJLB-WTDSWWLTSA-N |
| XLogP | 0.83 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|