C15H13BrFN3O2S — CID 1295683
1-[(5-bromo-2-hydroxybenzoyl)amino]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 1295683) has the molecular formula C15H13BrFN3O2S and a molecular weight of 398.26 g/mol. Its IUPAC name is 1-[(5-bromo-2-hydroxybenzoyl)amino]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[(5-bromo-2-hydroxybenzoyl)amino]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 1295683 |
| Molecular Formula | C15H13BrFN3O2S |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 1-[(5-bromo-2-hydroxybenzoyl)amino]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | O=C(NNC(=S)NCc1ccc(F)cc1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C15H13BrFN3O2S/c16-10-3-6-13(21)12(7-10)14(22)19-20-15(23)18-8-9-1-4-11(17)5-2-9/h1-7,21H,8H2,(H,19,22)(H2,18,20,23) |
| InChIKey | PFGXZMYMQGYMDL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|