C15H12ClFN4O3S — CID 8941766
1-[(4-chloro-2-nitrobenzoyl)amino]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 8941766) has the molecular formula C15H12ClFN4O3S and a molecular weight of 382.80 g/mol. Its IUPAC name is 1-[(4-chloro-2-nitrobenzoyl)amino]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[(4-chloro-2-nitrobenzoyl)amino]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8941766 |
| Molecular Formula | C15H12ClFN4O3S |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 1-[(4-chloro-2-nitrobenzoyl)amino]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | O=C(NNC(=S)NCc1ccc(F)cc1)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12ClFN4O3S/c16-10-3-6-12(13(7-10)21(23)24)14(22)19-20-15(25)18-8-9-1-4-11(17)5-2-9/h1-7H,8H2,(H,19,22)(H2,18,20,25) |
| InChIKey | NURHHPOGWAWKQE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|