C18H31NO — CID 142843546
N-butyl-3,5-dimethyl-N-propylbenzamide;ethane (PubChem CID 142843546) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is N-butyl-3,5-dimethyl-N-propylbenzamide;ethane.
| Compound Name | N-butyl-3,5-dimethyl-N-propylbenzamide;ethane |
|---|---|
| PubChem CID | 142843546 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | N-butyl-3,5-dimethyl-N-propylbenzamide;ethane |
| SMILES | CC.CCCCN(CCC)C(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H25NO.C2H6/c1-5-7-9-17(8-6-2)16(18)15-11-13(3)10-14(4)12-15;1-2/h10-12H,5-9H2,1-4H3;1-2H3 |
| InChIKey | PSKPWXUWFYDRGJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |