C12H14Br3NO — CID 107974886
3,5-dibromo-N-(2-bromoethyl)-N-propylbenzamide (PubChem CID 107974886) has the molecular formula C12H14Br3NO and a molecular weight of 427.96 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-bromoethyl)-N-propylbenzamide.
| Compound Name | 3,5-dibromo-N-(2-bromoethyl)-N-propylbenzamide |
|---|---|
| PubChem CID | 107974886 |
| Molecular Formula | C12H14Br3NO |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 424.86 |
| IUPAC Name | 3,5-dibromo-N-(2-bromoethyl)-N-propylbenzamide |
| SMILES | CCCN(CCBr)C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H14Br3NO/c1-2-4-16(5-3-13)12(17)9-6-10(14)8-11(15)7-9/h6-8H,2-5H2,1H3 |
| InChIKey | YFTFUWGKXDRQTF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|