C14H18F3NO3 — CID 63188742
3,4,5-trifluoro-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide (PubChem CID 63188742) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide.
| Compound Name | 3,4,5-trifluoro-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 63188742 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3,4,5-trifluoro-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CCOC)C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H18F3NO3/c1-20-6-3-4-18(5-7-21-2)14(19)10-8-11(15)13(17)12(16)9-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | UUZSNYXUJMCQCN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|