C14H21NO4 — CID 54989912
3-hydroxy-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide (PubChem CID 54989912) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-hydroxy-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-hydroxy-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 54989912 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-hydroxy-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CCOC)C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C14H21NO4/c1-18-9-4-7-15(8-10-19-2)14(17)12-5-3-6-13(16)11-12/h3,5-6,11,16H,4,7-10H2,1-2H3 |
| InChIKey | RIHQAHWVFOIOHP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|