C19H18N4O3S2 — CID 52689236
2-(diethylamino)-N-(2-methyl-1,3-dioxoisoindol-5-yl)thieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 52689236) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2-methyl-1,3-dioxoisoindol-5-yl)thieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 2-(diethylamino)-N-(2-methyl-1,3-dioxoisoindol-5-yl)thieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 52689236 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-(diethylamino)-N-(2-methyl-1,3-dioxoisoindol-5-yl)thieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | CCN(CC)c1nc2sc(C(=O)Nc3ccc4c(c3)C(=O)N(C)C4=O)cc2s1 |
| InChI | InChI=1S/C19H18N4O3S2/c1-4-23(5-2)19-21-16-14(28-19)9-13(27-16)15(24)20-10-6-7-11-12(8-10)18(26)22(3)17(11)25/h6-9H,4-5H2,1-3H3,(H,20,24) |
| InChIKey | CKGZVKRDDYPIBY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|