C22H15FN4O3S — CID 52894174
1-(4-fluorophenyl)-3-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 52894174) has the molecular formula C22H15FN4O3S and a molecular weight of 434.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-3-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 52894174 |
| Molecular Formula | C22H15FN4O3S |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 1-(4-fluorophenyl)-3-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c2sc(C(=O)Nc3ccc4c(c3)C(=O)N(C)C4=O)cc12 |
| InChI | InChI=1S/C22H15FN4O3S/c1-11-16-10-18(31-22(16)27(25-11)14-6-3-12(23)4-7-14)19(28)24-13-5-8-15-17(9-13)21(30)26(2)20(15)29/h3-10H,1-2H3,(H,24,28) |
| InChIKey | SMTIMFGNKHTORW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|