C16H17FN4OS — CID 119404788
N-(3-aminopropyl)-1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 119404788) has the molecular formula C16H17FN4OS and a molecular weight of 332.40 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-(3-aminopropyl)-1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 119404788 |
| Molecular Formula | C16H17FN4OS |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-(3-aminopropyl)-1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c2sc(C(=O)NCCCN)cc12 |
| InChI | InChI=1S/C16H17FN4OS/c1-10-13-9-14(15(22)19-8-2-7-18)23-16(13)21(20-10)12-5-3-11(17)4-6-12/h3-6,9H,2,7-8,18H2,1H3,(H,19,22) |
| InChIKey | OYWCSYTZTDOMJO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|