C18H22ClN4OS+ — CID 2420928
3-[[1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]propyl-dimethylazanium (PubChem CID 2420928) has the molecular formula C18H22ClN4OS+ and a molecular weight of 377.92 g/mol. Its IUPAC name is 3-[[1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 2420928 |
| Molecular Formula | C18H22ClN4OS+ |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-[[1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]propyl-dimethylazanium |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c2sc(C(=O)NCCC[NH+](C)C)cc12 |
| InChI | InChI=1S/C18H21ClN4OS/c1-12-15-11-16(17(24)20-9-4-10-22(2)3)25-18(15)23(21-12)14-7-5-13(19)6-8-14/h5-8,11H,4,9-10H2,1-3H3,(H,20,24)/p+1 |
| InChIKey | DJRFHZNWKPBVCV-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|