C22H15FN2O4 — CID 60538527
N-[4-(3-fluorophenoxy)phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 60538527) has the molecular formula C22H15FN2O4 and a molecular weight of 390.37 g/mol. Its IUPAC name is N-[4-(3-fluorophenoxy)phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-(3-fluorophenoxy)phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 60538527 |
| Molecular Formula | C22H15FN2O4 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[4-(3-fluorophenoxy)phenyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)Nc3ccc(Oc4cccc(F)c4)cc3)cc2C1=O |
| InChI | InChI=1S/C22H15FN2O4/c1-25-21(27)18-10-5-13(11-19(18)22(25)28)20(26)24-15-6-8-16(9-7-15)29-17-4-2-3-14(23)12-17/h2-12H,1H3,(H,24,26) |
| InChIKey | ZNZDHLVFTGLEDW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|