C16H10F2N2O3 — CID 26360019
N-(2,4-difluorophenyl)-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 26360019) has the molecular formula C16H10F2N2O3 and a molecular weight of 316.26 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 26360019 |
| Molecular Formula | C16H10F2N2O3 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)Nc3ccc(F)cc3F)cc2C1=O |
| InChI | InChI=1S/C16H10F2N2O3/c1-20-15(22)10-4-2-8(6-11(10)16(20)23)14(21)19-13-5-3-9(17)7-12(13)18/h2-7H,1H3,(H,19,21) |
| InChIKey | MBEOCYVCOFPGHB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|