C47H34N4O9 — CID 143437368
2-methyl-N-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxamide;6-methyl-2-[4-(4-methylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 143437368) has the molecular formula C47H34N4O9 and a molecular weight of 798.81 g/mol. Its IUPAC name is 2-methyl-N-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxamide;6-methyl-2-[4-(4-methylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-methyl-N-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxamide;6-methyl-2-[4-(4-methylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 143437368 |
| Molecular Formula | C47H34N4O9 |
| Molecular Weight | 798.81 g/mol |
| Exact Mass | 798.23 |
| IUPAC Name | 2-methyl-N-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxamide;6-methyl-2-[4-(4-methylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(Oc2ccc(-n3c(=O)c4cc5c(=O)n(C)c(=O)c5cc4c3=O)cc2)cc1.Cc1ccc(Oc2ccc(NC(=O)c3ccc4c(c3)C(=O)N(C)C4=O)cc2)cc1 |
| InChI | InChI=1S/C24H16N2O5.C23H18N2O4/c1-13-3-7-15(8-4-13)31-16-9-5-14(6-10-16)26-23(29)19-11-17-18(12-20(19)24(26)30)22(28)25(2)21(17)27;1-14-3-8-17(9-4-14)29-18-10-6-16(7-11-18)24-21(26)15-5-12-19-20(13-15)23(28)25(2)22(19)27/h3-12H,1-2H3;3-13H,1-2H3,(H,24,26) |
| InChIKey | WZMWPSJZOMMGLH-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 163.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.81 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|