C24H17N3O4 — CID 142452691
N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-4-(3-methoxyphenyl)benzamide (PubChem CID 142452691) has the molecular formula C24H17N3O4 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-4-(3-methoxyphenyl)benzamide.
| Compound Name | N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-4-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 142452691 |
| Molecular Formula | C24H17N3O4 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-[2-(cyanomethyl)-1,3-dioxoisoindol-5-yl]-4-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2ccc(C(=O)Nc3ccc4c(c3)C(=O)N(CC#N)C4=O)cc2)c1 |
| InChI | InChI=1S/C24H17N3O4/c1-31-19-4-2-3-17(13-19)15-5-7-16(8-6-15)22(28)26-18-9-10-20-21(14-18)24(30)27(12-11-25)23(20)29/h2-10,13-14H,12H2,1H3,(H,26,28) |
| InChIKey | KWXOBCBKXNEZAH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|