C16H10ClN3O — CID 107788654
3-(chloromethyl)-N-(3,4-dicyanophenyl)benzamide (PubChem CID 107788654) has the molecular formula C16H10ClN3O and a molecular weight of 295.73 g/mol. Its IUPAC name is 3-(chloromethyl)-N-(3,4-dicyanophenyl)benzamide.
| Compound Name | 3-(chloromethyl)-N-(3,4-dicyanophenyl)benzamide |
|---|---|
| PubChem CID | 107788654 |
| Molecular Formula | C16H10ClN3O |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-(chloromethyl)-N-(3,4-dicyanophenyl)benzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cccc(CCl)c2)cc1C#N |
| InChI | InChI=1S/C16H10ClN3O/c17-8-11-2-1-3-12(6-11)16(21)20-15-5-4-13(9-18)14(7-15)10-19/h1-7H,8H2,(H,20,21) |
| InChIKey | IZMJXOLICQQMKT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|