C10H8N4OS — CID 19114266
(E)-3-phenyl-N-(thiatriazol-5-yl)prop-2-enamide (PubChem CID 19114266) has the molecular formula C10H8N4OS and a molecular weight of 232.27 g/mol. Its IUPAC name is (E)-3-phenyl-N-(thiatriazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-(thiatriazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19114266 |
| Molecular Formula | C10H8N4OS |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | (E)-3-phenyl-N-(thiatriazol-5-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1nnns1 |
| InChI | InChI=1S/C10H8N4OS/c15-9(11-10-12-13-14-16-10)7-6-8-4-2-1-3-5-8/h1-7H,(H,11,12,14,15)/b7-6+ |
| InChIKey | MCBMEZGRSDPRES-VOTSOKGWSA-N |
| XLogP | 1.59 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|