C16H13Cl2NO2 — CID 76905371
3-(2,5-dichlorophenyl)-N-[2-(hydroxymethyl)phenyl]prop-2-enamide (PubChem CID 76905371) has the molecular formula C16H13Cl2NO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-N-[2-(hydroxymethyl)phenyl]prop-2-enamide.
| Compound Name | 3-(2,5-dichlorophenyl)-N-[2-(hydroxymethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76905371 |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-N-[2-(hydroxymethyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cc(Cl)ccc1Cl)Nc1ccccc1CO |
| InChI | InChI=1S/C16H13Cl2NO2/c17-13-6-7-14(18)11(9-13)5-8-16(21)19-15-4-2-1-3-12(15)10-20/h1-9,20H,10H2,(H,19,21) |
| InChIKey | ZBQSHPHVGQLEPL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|