C22H22F2N4O2 — CID 111901585
N-[3-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 111901585) has the molecular formula C22H22F2N4O2 and a molecular weight of 412.44 g/mol. Its IUPAC name is N-[3-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111901585 |
| Molecular Formula | C22H22F2N4O2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[3-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)c2ccco2)c1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C22H22F2N4O2/c1-2-25-22(27-14-16-12-17(23)8-9-19(16)24)26-13-15-5-3-6-18(11-15)28-21(29)20-7-4-10-30-20/h3-12H,2,13-14H2,1H3,(H,28,29)(H2,25,26,27) |
| InChIKey | XMQPCKFVFHBYTG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|