C23H29IN4O2S — CID 111581539
N-[3-[[[ethylamino-[(2-methyl-2-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111581539) has the molecular formula C23H29IN4O2S and a molecular weight of 552.48 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(2-methyl-2-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(2-methyl-2-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111581539 |
| Molecular Formula | C23H29IN4O2S |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | N-[3-[[[ethylamino-[(2-methyl-2-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)c2ccco2)c1)NCC(C)(C)c1cccs1.I |
| InChI | InChI=1S/C23H28N4O2S.HI/c1-4-24-22(26-16-23(2,3)20-11-7-13-30-20)25-15-17-8-5-9-18(14-17)27-21(28)19-10-6-12-29-19;/h5-14H,4,15-16H2,1-3H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | CPRMDQSJOQLSCF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|