C22H27IN4O3S — CID 109419439
N-[4-[[[ethylamino-[(2-hydroxy-2-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 109419439) has the molecular formula C22H27IN4O3S and a molecular weight of 554.45 g/mol. Its IUPAC name is N-[4-[[[ethylamino-[(2-hydroxy-2-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[ethylamino-[(2-hydroxy-2-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109419439 |
| Molecular Formula | C22H27IN4O3S |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | N-[4-[[[ethylamino-[(2-hydroxy-2-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)c2ccco2)cc1)NCC(C)(O)c1cccs1.I |
| InChI | InChI=1S/C22H26N4O3S.HI/c1-3-23-21(25-15-22(2,28)19-7-5-13-30-19)24-14-16-8-10-17(11-9-16)26-20(27)18-6-4-12-29-18;/h4-13,28H,3,14-15H2,1-2H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | UEJYDDXGDHIUSC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|