C17H23IN4O3S — CID 109420165
1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 109420165) has the molecular formula C17H23IN4O3S and a molecular weight of 490.37 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420165 |
| Molecular Formula | C17H23IN4O3S |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC(C)(O)c1cccs1.I |
| InChI | InChI=1S/C17H22N4O3S.HI/c1-3-18-16(20-12-17(2,22)15-5-4-10-25-15)19-11-13-6-8-14(9-7-13)21(23)24;/h4-10,22H,3,11-12H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | QTKPSFOXZIHMHY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|