C23H35N5OS — CID 109420340
1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 109420340) has the molecular formula C23H35N5OS and a molecular weight of 429.63 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109420340 |
| Molecular Formula | C23H35N5OS |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCN(C)CC2)cc1)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C23H35N5OS/c1-4-24-22(26-18-23(2,29)21-6-5-15-30-21)25-16-19-7-9-20(10-8-19)17-28-13-11-27(3)12-14-28/h5-10,15,29H,4,11-14,16-18H2,1-3H3,(H2,24,25,26) |
| InChIKey | FLPHAJSSQXGQHY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|