C23H34N4OS — CID 111582172
1-ethyl-3-(2-methyl-2-thiophen-2-ylpropyl)-2-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111582172) has the molecular formula C23H34N4OS and a molecular weight of 414.62 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-2-thiophen-2-ylpropyl)-2-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-methyl-2-thiophen-2-ylpropyl)-2-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111582172 |
| Molecular Formula | C23H34N4OS |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 1-ethyl-3-(2-methyl-2-thiophen-2-ylpropyl)-2-[[4-(morpholin-4-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCOCC2)cc1)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C23H34N4OS/c1-4-24-22(26-18-23(2,3)21-6-5-15-29-21)25-16-19-7-9-20(10-8-19)17-27-11-13-28-14-12-27/h5-10,15H,4,11-14,16-18H2,1-3H3,(H2,24,25,26) |
| InChIKey | PBAWKYVUYXUGMC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|