C15H17BrIN3O2S — CID 119119354
2-[(5-bromothiophen-3-yl)methyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide (PubChem CID 119119354) has the molecular formula C15H17BrIN3O2S and a molecular weight of 510.20 g/mol. Its IUPAC name is 2-[(5-bromothiophen-3-yl)methyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide.
| Compound Name | 2-[(5-bromothiophen-3-yl)methyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119119354 |
| Molecular Formula | C15H17BrIN3O2S |
| Molecular Weight | 510.20 g/mol |
| Exact Mass | 508.93 |
| IUPAC Name | 2-[(5-bromothiophen-3-yl)methyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1csc(Br)c1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C15H16BrN3O2S.HI/c16-14-6-10(9-22-14)8-18-15(17)19-11-2-3-12-13(7-11)21-5-1-4-20-12;/h2-3,6-7,9H,1,4-5,8H2,(H3,17,18,19);1H |
| InChIKey | AUKSGDWIMGYPEJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|