C18H28N4O3 — CID 110044765
2-[[(cyclopentylamino)-(3,4-dimethoxyanilino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110044765) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-(3,4-dimethoxyanilino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclopentylamino)-(3,4-dimethoxyanilino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110044765 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 2-[[(cyclopentylamino)-(3,4-dimethoxyanilino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(N/C(=N/CC(=O)N(C)C)NC2CCCC2)cc1OC |
| InChI | InChI=1S/C18H28N4O3/c1-22(2)17(23)12-19-18(20-13-7-5-6-8-13)21-14-9-10-15(24-3)16(11-14)25-4/h9-11,13H,5-8,12H2,1-4H3,(H2,19,20,21) |
| InChIKey | AYLVYSHVHSNKII-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|